C16H22O2Si — CID 101235926
dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-phenylsilane (PubChem CID 101235926) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-phenylsilane.
| Compound Name | dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-phenylsilane |
|---|---|
| PubChem CID | 101235926 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-phenylsilane |
| SMILES | C=C=C(OC1CCCCO1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H22O2Si/c1-4-16(18-15-12-8-9-13-17-15)19(2,3)14-10-6-5-7-11-14/h5-7,10-11,15H,1,8-9,12-13H2,2-3H3 |
| InChIKey | RZALPDYYUSNIHZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|