C31H46O3Si — CID 91332140
tert-butyl-[10-(oxan-2-yloxy)dec-3-enoxy]-diphenylsilane (PubChem CID 91332140) has the molecular formula C31H46O3Si and a molecular weight of 494.79 g/mol. Its IUPAC name is tert-butyl-[10-(oxan-2-yloxy)dec-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[10-(oxan-2-yloxy)dec-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 91332140 |
| Molecular Formula | C31H46O3Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | tert-butyl-[10-(oxan-2-yloxy)dec-3-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC=CCCCCCCOC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H46O3Si/c1-31(2,3)35(28-20-12-10-13-21-28,29-22-14-11-15-23-29)34-27-18-9-7-5-4-6-8-17-25-32-30-24-16-19-26-33-30/h7,9-15,20-23,30H,4-6,8,16-19,24-27H2,1-3H3 |
| InChIKey | FVUBHSDQMOYANA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|