C25H34F2O3Si — CID 175967985
tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane (PubChem CID 175967985) has the molecular formula C25H34F2O3Si and a molecular weight of 448.63 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane |
|---|---|
| PubChem CID | 175967985 |
| Molecular Formula | C25H34F2O3Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC(F)(F)CCO[C@@H]1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34F2O3Si/c1-24(2,3)31(21-12-6-4-7-13-21,22-14-8-5-9-15-22)30-20-25(26,27)17-19-29-23-16-10-11-18-28-23/h4-9,12-15,23H,10-11,16-20H2,1-3H3/t23-/m1/s1 |
| InChIKey | ITTCIHFTQHROTR-HSZRJFAPSA-N |
| XLogP | 5.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|