About tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane
tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane (PubChem CID 175967985) has the molecular formula C25H34F2O3Si
and a molecular weight of 448.63 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane |
| PubChem CID | 175967985 |
| Molecular Formula | C25H34F2O3Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC(F)(F)CCO[C@@H]1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34F2O3Si/c1-24(2,3)31(21-12-6-4-7-13-21,22-14-8-5-9-15-22)30-20-25(26,27)17-19-29-23-16-10-11-18-28-23/h4-9,12-15,23H,10-11,16-20H2,1-3H3/t23-/m1/s1 |
| InChIKey | ITTCIHFTQHROTR-HSZRJFAPSA-N |
| XLogP | 5.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane (CID 175967985) is tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane is CC(C)(C)[Si](OCC(F)(F)CCO[C@@H]1CCCCO1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane?
The InChIKey is ITTCIHFTQHROTR-HSZRJFAPSA-N. The full InChI is InChI=1S/C25H34F2O3Si/c1-24(2,3)31(21-12-6-4-7-13-21,22-14-8-5-9-15-22)30-20-25(26,27)17-19-29-23-16-10-11-18-28-23/h4-9,12-15,23H,10-11,16-20H2,1-3H3/t23-/m1/s1.
What are the key properties of tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane?
tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane has a molecular weight of 448.63 g/mol, XLogP of 5.13, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2,2-difluoro-4-[(2R)-oxan-2-yl]oxybutoxy]-diphenylsilane is sourced from PubChem (CID 175967985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).