C28H39FO3Si — CID 139774217
tert-butyl-[(E)-6-fluoro-7-(oxan-2-yloxy)hept-5-enoxy]-diphenylsilane (PubChem CID 139774217) has the molecular formula C28H39FO3Si and a molecular weight of 470.70 g/mol. Its IUPAC name is tert-butyl-[(E)-6-fluoro-7-(oxan-2-yloxy)hept-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-6-fluoro-7-(oxan-2-yloxy)hept-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 139774217 |
| Molecular Formula | C28H39FO3Si |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | tert-butyl-[(E)-6-fluoro-7-(oxan-2-yloxy)hept-5-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCC/C=C(/F)COC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39FO3Si/c1-28(2,3)33(25-16-8-4-9-17-25,26-18-10-5-11-19-26)32-22-13-6-7-15-24(29)23-31-27-20-12-14-21-30-27/h4-5,8-11,15-19,27H,6-7,12-14,20-23H2,1-3H3/b24-15+ |
| InChIKey | IQCUKEVUGPZKQV-BUVRLJJBSA-N |
| XLogP | 6.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|