C21H24O2Si — CID 101235927
methyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-diphenylsilane (PubChem CID 101235927) has the molecular formula C21H24O2Si and a molecular weight of 336.51 g/mol. Its IUPAC name is methyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-diphenylsilane.
| Compound Name | methyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-diphenylsilane |
|---|---|
| PubChem CID | 101235927 |
| Molecular Formula | C21H24O2Si |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]-diphenylsilane |
| SMILES | C=C=C(OC1CCCCO1)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O2Si/c1-3-21(23-20-16-10-11-17-22-20)24(2,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15,20H,1,10-11,16-17H2,2H3 |
| InChIKey | GQAVSGBVAMPJJA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|