C29H28NOPS2 — CID 101236467
O-ethyl [5-methyl-2-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylsulfanylmethanethioate (PubChem CID 101236467) has the molecular formula C29H28NOPS2 and a molecular weight of 501.66 g/mol. Its IUPAC name is O-ethyl [5-methyl-2-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylsulfanylmethanethioate.
| Compound Name | O-ethyl [5-methyl-2-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 101236467 |
| Molecular Formula | C29H28NOPS2 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | O-ethyl [5-methyl-2-[(triphenyl-λ5-phosphanylidene)amino]phenyl]methylsulfanylmethanethioate |
| SMILES | CCOC(=S)SCc1cc(C)ccc1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28NOPS2/c1-3-31-29(33)34-22-24-21-23(2)19-20-28(24)30-32(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-21H,3,22H2,1-2H3 |
| InChIKey | GKINTWOOSMHGHM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|