C16H22O4S4 — CID 101173799
O-ethyl [4-(ethoxycarbothioylsulfanylmethyl)-2,5-dimethoxyphenyl]methylsulfanylmethanethioate (PubChem CID 101173799) has the molecular formula C16H22O4S4 and a molecular weight of 406.62 g/mol. Its IUPAC name is O-ethyl [4-(ethoxycarbothioylsulfanylmethyl)-2,5-dimethoxyphenyl]methylsulfanylmethanethioate.
| Compound Name | O-ethyl [4-(ethoxycarbothioylsulfanylmethyl)-2,5-dimethoxyphenyl]methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 101173799 |
| Molecular Formula | C16H22O4S4 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | O-ethyl [4-(ethoxycarbothioylsulfanylmethyl)-2,5-dimethoxyphenyl]methylsulfanylmethanethioate |
| SMILES | CCOC(=S)SCc1cc(OC)c(CSC(=S)OCC)cc1OC |
| InChI | InChI=1S/C16H22O4S4/c1-5-19-15(21)23-9-11-7-14(18-4)12(8-13(11)17-3)10-24-16(22)20-6-2/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | VGRBVRXDFSTMJK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|