C21H28O7S3 — CID 158607964
(2,3-dimethoxy-5-sulfanylphenyl)methanol;O-ethyl [3-(hydroxymethyl)-4,5-dimethoxyphenyl]sulfanylmethanethioate (PubChem CID 158607964) has the molecular formula C21H28O7S3 and a molecular weight of 488.65 g/mol. Its IUPAC name is (2,3-dimethoxy-5-sulfanylphenyl)methanol;O-ethyl [3-(hydroxymethyl)-4,5-dimethoxyphenyl]sulfanylmethanethioate.
| Compound Name | (2,3-dimethoxy-5-sulfanylphenyl)methanol;O-ethyl [3-(hydroxymethyl)-4,5-dimethoxyphenyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 158607964 |
| Molecular Formula | C21H28O7S3 |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (2,3-dimethoxy-5-sulfanylphenyl)methanol;O-ethyl [3-(hydroxymethyl)-4,5-dimethoxyphenyl]sulfanylmethanethioate |
| SMILES | CCOC(=S)Sc1cc(CO)c(OC)c(OC)c1.COc1cc(S)cc(CO)c1OC |
| InChI | InChI=1S/C12H16O4S2.C9H12O3S/c1-4-16-12(17)18-9-5-8(7-13)11(15-3)10(6-9)14-2;1-11-8-4-7(13)3-6(5-10)9(8)12-2/h5-6,13H,4,7H2,1-3H3;3-4,10,13H,5H2,1-2H3 |
| InChIKey | HWLXDVNILBMHPG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|