C22H35NO3 — CID 101236895
[(2R,3S,5E,9Z,12Z,15Z)-2-acetamidooctadeca-5,9,12,15-tetraen-3-yl] acetate (PubChem CID 101236895) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is [(2R,3S,5E,9Z,12Z,15Z)-2-acetamidooctadeca-5,9,12,15-tetraen-3-yl] acetate.
| Compound Name | [(2R,3S,5E,9Z,12Z,15Z)-2-acetamidooctadeca-5,9,12,15-tetraen-3-yl] acetate |
|---|---|
| PubChem CID | 101236895 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | [(2R,3S,5E,9Z,12Z,15Z)-2-acetamidooctadeca-5,9,12,15-tetraen-3-yl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC/C=C/C[C@H](OC(C)=O)[C@@H](C)NC(C)=O |
| InChI | InChI=1S/C22H35NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(26-21(4)25)19(2)23-20(3)24/h6-7,9-10,12-13,16-17,19,22H,5,8,11,14-15,18H2,1-4H3,(H,23,24)/b7-6-,10-9-,13-12-,17-16+/t19-,22+/m1/s1 |
| InChIKey | TXJONNFBEAGDGK-ZFJPZKQUSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|