C21H32O5 — CID 101236999
methyl (2S,6R,7S,8R,9R,11R,13R,14R)-11-ethoxy-14-hydroxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate (PubChem CID 101236999) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is methyl (2S,6R,7S,8R,9R,11R,13R,14R)-11-ethoxy-14-hydroxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate.
| Compound Name | methyl (2S,6R,7S,8R,9R,11R,13R,14R)-11-ethoxy-14-hydroxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
|---|---|
| PubChem CID | 101236999 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl (2S,6R,7S,8R,9R,11R,13R,14R)-11-ethoxy-14-hydroxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
| SMILES | CCO[C@H]1C[C@@H]2C3=C(CC[C@H]2O)[C@H]2CCC[C@@H](C)[C@@H]2[C@@H](C(=O)OC)[C@H]3O1 |
| InChI | InChI=1S/C21H32O5/c1-4-25-16-10-14-15(22)9-8-13-12-7-5-6-11(2)17(12)19(21(23)24-3)20(26-16)18(13)14/h11-12,14-17,19-20,22H,4-10H2,1-3H3/t11-,12-,14+,15-,16-,17+,19-,20+/m1/s1 |
| InChIKey | QCRNUPHZGKOKCQ-LDPLWEKSSA-N |
| XLogP | 3.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|