C25H38O8 — CID 134864784
7-O,8-O-diethyl 12-O-methyl (3R,5S,6S,7R,8S)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate (PubChem CID 134864784) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is 7-O,8-O-diethyl 12-O-methyl (3R,5S,6S,7R,8S)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate.
| Compound Name | 7-O,8-O-diethyl 12-O-methyl (3R,5S,6S,7R,8S)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate |
|---|---|
| PubChem CID | 134864784 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 7-O,8-O-diethyl 12-O-methyl (3R,5S,6S,7R,8S)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C2=C3C(O[C@@H](OCC)C[C@H]3[C@H](C)[C@H]1C(=O)OCC)C(C(=O)OC)CC2(C)C |
| InChI | InChI=1S/C25H38O8/c1-8-30-16-11-14-13(4)17(23(27)31-9-2)19(24(28)32-10-3)20-18(14)21(33-16)15(22(26)29-7)12-25(20,5)6/h13-17,19,21H,8-12H2,1-7H3/t13-,14-,15?,16+,17+,19-,21?/m0/s1 |
| InChIKey | LPJZLIGPUWRALK-WNSXHDLZSA-N |
| XLogP | 3.28 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|