C23H34O8 — CID 101236998
trimethyl (1R,3R,5S,6S,7S,8R)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate (PubChem CID 101236998) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is trimethyl (1R,3R,5S,6S,7S,8R)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate.
| Compound Name | trimethyl (1R,3R,5S,6S,7S,8R)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate |
|---|---|
| PubChem CID | 101236998 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | trimethyl (1R,3R,5S,6S,7S,8R)-3-ethoxy-6,10,10-trimethyl-2-oxatricyclo[7.3.1.05,13]tridec-9(13)-ene-7,8,12-tricarboxylate |
| SMILES | CCO[C@H]1C[C@@H]2C3=C([C@H](C(=O)OC)[C@@H](C(=O)OC)[C@H]2C)C(C)(C)CC(C(=O)OC)[C@H]3O1 |
| InChI | InChI=1S/C23H34O8/c1-8-30-14-9-12-11(2)15(21(25)28-6)17(22(26)29-7)18-16(12)19(31-14)13(20(24)27-5)10-23(18,3)4/h11-15,17,19H,8-10H2,1-7H3/t11-,12-,13?,14+,15-,17+,19+/m0/s1 |
| InChIKey | XUQFHWVHMDXQAS-HWISSUEMSA-N |
| XLogP | 2.50 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|