C20H30O4 — CID 10042531
methyl (2S,7S,8R,9R,11R,13R)-11-ethoxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate (PubChem CID 10042531) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is methyl (2S,7S,8R,9R,11R,13R)-11-ethoxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate.
| Compound Name | methyl (2S,7S,8R,9R,11R,13R)-11-ethoxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
|---|---|
| PubChem CID | 10042531 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | methyl (2S,7S,8R,9R,11R,13R)-11-ethoxy-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
| SMILES | CCO[C@H]1C[C@H]2CCCC3=C2[C@H](O1)[C@H](C(=O)OC)[C@H]1CCCC[C@H]31 |
| InChI | InChI=1S/C20H30O4/c1-3-23-16-11-12-7-6-10-14-13-8-4-5-9-15(13)18(20(21)22-2)19(24-16)17(12)14/h12-13,15-16,18-19H,3-11H2,1-2H3/t12-,13-,15+,16-,18-,19+/m1/s1 |
| InChIKey | LHGQDKDNAAGOMZ-VWCOGEDFSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|