C18H24O5 — CID 10336135
(5S,7S,9R,10R,14R,15S)-7-ethoxy-15-ethyl-8,12-dioxatetracyclo[7.6.1.05,16.010,14]hexadec-1(16)-ene-11,13-dione (PubChem CID 10336135) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (5S,7S,9R,10R,14R,15S)-7-ethoxy-15-ethyl-8,12-dioxatetracyclo[7.6.1.05,16.010,14]hexadec-1(16)-ene-11,13-dione.
| Compound Name | (5S,7S,9R,10R,14R,15S)-7-ethoxy-15-ethyl-8,12-dioxatetracyclo[7.6.1.05,16.010,14]hexadec-1(16)-ene-11,13-dione |
|---|---|
| PubChem CID | 10336135 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (5S,7S,9R,10R,14R,15S)-7-ethoxy-15-ethyl-8,12-dioxatetracyclo[7.6.1.05,16.010,14]hexadec-1(16)-ene-11,13-dione |
| SMILES | CCO[C@@H]1C[C@@H]2CCCC3=C2[C@H](O1)[C@@H]1C(=O)OC(=O)[C@@H]1[C@@H]3CC |
| InChI | InChI=1S/C18H24O5/c1-3-10-11-7-5-6-9-8-12(21-4-2)22-16(13(9)11)15-14(10)17(19)23-18(15)20/h9-10,12,14-16H,3-8H2,1-2H3/t9-,10+,12-,14+,15+,16-/m0/s1 |
| InChIKey | FDUYCHAISFFUGZ-JGVWZZTMSA-N |
| XLogP | 2.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|