C27H46O5Si — CID 101237006
methyl (2R,6R,7R,8S,9S,11R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate (PubChem CID 101237006) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is methyl (2R,6R,7R,8S,9S,11R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate.
| Compound Name | methyl (2R,6R,7R,8S,9S,11R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
|---|---|
| PubChem CID | 101237006 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | methyl (2R,6R,7R,8S,9S,11R,13R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-11-ethoxy-6-methyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-1(17)-ene-8-carboxylate |
| SMILES | CCO[C@H]1C[C@@H]2C3=C(CC[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]2CCC[C@@H](C)[C@H]2[C@H](C(=O)OC)[C@@H]3O1 |
| InChI | InChI=1S/C27H46O5Si/c1-9-30-21-15-19-20(32-33(7,8)27(3,4)5)14-13-18-17-12-10-11-16(2)22(17)24(26(28)29-6)25(31-21)23(18)19/h16-17,19-22,24-25H,9-15H2,1-8H3/t16-,17+,19+,20-,21-,22-,24+,25-/m1/s1 |
| InChIKey | ABZVPBRSPPIVFX-DBOLLOCUSA-N |
| XLogP | 6.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|