C15H17O4 — CID 101238236
CID 101238236 (PubChem CID 101238236) has the molecular formula C15H17O4 and a molecular weight of 261.30 g/mol.
| Compound Name | CID 101238236 |
|---|---|
| PubChem CID | 101238236 |
| Molecular Formula | C15H17O4 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | — |
| SMILES | C=CCC(Cc1[c]cccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H17O4/c1-4-10-15(13(16)18-2,14(17)19-3)11-12-8-6-5-7-9-12/h4-8H,1,10-11H2,2-3H3 |
| InChIKey | MZMHXQUKAOIANY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|