C29H30N2O4 — CID 101239739
[(6S,7S,8S)-6,7,8-tris(phenylmethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanol (PubChem CID 101239739) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is [(6S,7S,8S)-6,7,8-tris(phenylmethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanol.
| Compound Name | [(6S,7S,8S)-6,7,8-tris(phenylmethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 101239739 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [(6S,7S,8S)-6,7,8-tris(phenylmethoxy)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]methanol |
| SMILES | OCc1cn2c(n1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C2 |
| InChI | InChI=1S/C29H30N2O4/c32-18-25-16-31-17-26(33-19-22-10-4-1-5-11-22)27(34-20-23-12-6-2-7-13-23)28(29(31)30-25)35-21-24-14-8-3-9-15-24/h1-16,26-28,32H,17-21H2/t26-,27-,28+/m0/s1 |
| InChIKey | NWUNKLCCFBMYBM-HZFUHODCSA-N |
| XLogP | 4.82 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |