C18H19BrClNO4S — CID 101240514
ethyl (2S,3R)-3-bromo-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 101240514) has the molecular formula C18H19BrClNO4S and a molecular weight of 460.78 g/mol. Its IUPAC name is ethyl (2S,3R)-3-bromo-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl (2S,3R)-3-bromo-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 101240514 |
| Molecular Formula | C18H19BrClNO4S |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | ethyl (2S,3R)-3-bromo-3-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19BrClNO4S/c1-3-25-18(22)17(16(19)13-6-8-14(20)9-7-13)21-26(23,24)15-10-4-12(2)5-11-15/h4-11,16-17,21H,3H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | BRTZAHOHEFREIW-IAGOWNOFSA-N |
| XLogP | 3.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|