C30H52O4 — CID 101245070
bis(2-ethylhexyl) (1R,2R,3R,4R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 101245070) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is bis(2-ethylhexyl) (1R,2R,3R,4R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | bis(2-ethylhexyl) (1R,2R,3R,4R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101245070 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | bis(2-ethylhexyl) (1R,2R,3R,4R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)[C@H]1[C@H](C(=O)OCC(CC)CCCC)[C@H]2C=C(C)[C@@H]1CC2C(C)C |
| InChI | InChI=1S/C30H52O4/c1-8-12-14-22(10-3)18-33-29(31)27-25-17-24(20(5)6)26(16-21(25)7)28(27)30(32)34-19-23(11-4)15-13-9-2/h16,20,22-28H,8-15,17-19H2,1-7H3/t22?,23?,24?,25-,26-,27+,28+/m0/s1 |
| InChIKey | OKUOIDPYBTXDQJ-XCOMMOOWSA-N |
| XLogP | 7.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|