C35H30F17N3O3 — CID 101245504
[(R)-[(2S,4S,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-aminobenzoate (PubChem CID 101245504) has the molecular formula C35H30F17N3O3 and a molecular weight of 863.61 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-aminobenzoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 101245504 |
| Molecular Formula | C35H30F17N3O3 |
| Molecular Weight | 863.61 g/mol |
| Exact Mass | 863.20 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-aminobenzoate |
| SMILES | COc1ccc2nccc([C@@H](OC(=O)c3ccc(N)cc3)[C@@H]3C[C@@H]4CCN3C[C@@H]4CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C35H30F17N3O3/c1-57-21-6-7-24-23(15-21)22(9-12-54-24)26(58-27(56)17-2-4-20(53)5-3-17)25-14-18-10-13-55(25)16-19(18)8-11-28(36,37)29(38,39)30(40,41)31(42,43)32(44,45)33(46,47)34(48,49)35(50,51)52/h2-7,9,12,15,18-19,25-26H,8,10-11,13-14,16,53H2,1H3/t18-,19-,25-,26+/m0/s1 |
| InChIKey | JJZQMRNHUVDZRU-QSCAOHDJSA-N |
| XLogP | 10.22 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.61 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|