C14H15NO2 — CID 101246147
pyridin-2-ylmethyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101246147) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is pyridin-2-ylmethyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | pyridin-2-ylmethyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101246147 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | pyridin-2-ylmethyl (1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCc1ccccn1)[C@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H15NO2/c16-14(13-8-10-4-5-11(13)7-10)17-9-12-3-1-2-6-15-12/h1-6,10-11,13H,7-9H2/t10-,11+,13+/m1/s1 |
| InChIKey | YLIPCIWACBGWPW-MDZLAQPJSA-N |
| XLogP | 2.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|