C16H16O4 — CID 171393614
(3-formyl-4-hydroxyphenyl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 171393614) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3-formyl-4-hydroxyphenyl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (3-formyl-4-hydroxyphenyl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 171393614 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (3-formyl-4-hydroxyphenyl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=Cc1cc(COC(=O)C2CC3C=CC2C3)ccc1O |
| InChI | InChI=1S/C16H16O4/c17-8-13-6-11(2-4-15(13)18)9-20-16(19)14-7-10-1-3-12(14)5-10/h1-4,6,8,10,12,14,18H,5,7,9H2 |
| InChIKey | JFHTVWVHYSGIOW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|