C17H11Cl2N3OS — CID 101246497
3,5-dichloro-N-[2-(1,2-dicyanoethylsulfanyl)phenyl]benzamide (PubChem CID 101246497) has the molecular formula C17H11Cl2N3OS and a molecular weight of 376.27 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(1,2-dicyanoethylsulfanyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(1,2-dicyanoethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 101246497 |
| Molecular Formula | C17H11Cl2N3OS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 3,5-dichloro-N-[2-(1,2-dicyanoethylsulfanyl)phenyl]benzamide |
| SMILES | N#CCC(C#N)Sc1ccccc1NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2N3OS/c18-12-7-11(8-13(19)9-12)17(23)22-15-3-1-2-4-16(15)24-14(10-21)5-6-20/h1-4,7-9,14H,5H2,(H,22,23) |
| InChIKey | CDUFKAWWLYWHCR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |