C21H29NaO5 — CID 101246684
sodium 4-[8-[(4-ethenylphenyl)methoxy]octoxy]-4-oxobutanoate (PubChem CID 101246684) has the molecular formula C21H29NaO5 and a molecular weight of 384.45 g/mol. Its IUPAC name is sodium 4-[8-[(4-ethenylphenyl)methoxy]octoxy]-4-oxobutanoate.
| Compound Name | sodium 4-[8-[(4-ethenylphenyl)methoxy]octoxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 101246684 |
| Molecular Formula | C21H29NaO5 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | sodium 4-[8-[(4-ethenylphenyl)methoxy]octoxy]-4-oxobutanoate |
| SMILES | C=Cc1ccc(COCCCCCCCCOC(=O)CCC(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C21H30O5.Na/c1-2-18-9-11-19(12-10-18)17-25-15-7-5-3-4-6-8-16-26-21(24)14-13-20(22)23;/h2,9-12H,1,3-8,13-17H2,(H,22,23);/q;+1/p-1 |
| InChIKey | SUVQWRQNNIGYSH-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|