C21H20O4S — CID 101247407
ethyl 3-cyclohexyl-4,5-dioxobenzo[g][1]benzothiole-2-carboxylate (PubChem CID 101247407) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-4,5-dioxobenzo[g][1]benzothiole-2-carboxylate.
| Compound Name | ethyl 3-cyclohexyl-4,5-dioxobenzo[g][1]benzothiole-2-carboxylate |
|---|---|
| PubChem CID | 101247407 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | ethyl 3-cyclohexyl-4,5-dioxobenzo[g][1]benzothiole-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1C1CCCCC1)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H20O4S/c1-2-25-21(24)20-15(12-8-4-3-5-9-12)16-18(23)17(22)13-10-6-7-11-14(13)19(16)26-20/h6-7,10-12H,2-5,8-9H2,1H3 |
| InChIKey | IJQHTDDPZZHNDL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|