C17H16O4S2 — CID 102253920
ethyl 3-(2-methylpropyl)-4,5-dioxothieno[3,2-g][1]benzothiole-2-carboxylate (PubChem CID 102253920) has the molecular formula C17H16O4S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 3-(2-methylpropyl)-4,5-dioxothieno[3,2-g][1]benzothiole-2-carboxylate.
| Compound Name | ethyl 3-(2-methylpropyl)-4,5-dioxothieno[3,2-g][1]benzothiole-2-carboxylate |
|---|---|
| PubChem CID | 102253920 |
| Molecular Formula | C17H16O4S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl 3-(2-methylpropyl)-4,5-dioxothieno[3,2-g][1]benzothiole-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1CC(C)C)C(=O)C(=O)c1ccsc1-2 |
| InChI | InChI=1S/C17H16O4S2/c1-4-21-17(20)15-10(7-8(2)3)11-13(19)12(18)9-5-6-22-14(9)16(11)23-15/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | RKIVDXCQPNAKSI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|