C12H18O2S — CID 165449335
ethyl 3-(2-methylbutyl)thiophene-2-carboxylate (PubChem CID 165449335) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is ethyl 3-(2-methylbutyl)thiophene-2-carboxylate.
| Compound Name | ethyl 3-(2-methylbutyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 165449335 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl 3-(2-methylbutyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sccc1CC(C)CC |
| InChI | InChI=1S/C12H18O2S/c1-4-9(3)8-10-6-7-15-11(10)12(13)14-5-2/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | XCTRFGQJBRNXKI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |