C11H16N2O3S — CID 71987902
3-(carbamoylamino)propyl 3-ethylthiophene-2-carboxylate (PubChem CID 71987902) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-(carbamoylamino)propyl 3-ethylthiophene-2-carboxylate.
| Compound Name | 3-(carbamoylamino)propyl 3-ethylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 71987902 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(carbamoylamino)propyl 3-ethylthiophene-2-carboxylate |
| SMILES | CCc1ccsc1C(=O)OCCCNC(N)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-2-8-4-7-17-9(8)10(14)16-6-3-5-13-11(12)15/h4,7H,2-3,5-6H2,1H3,(H3,12,13,15) |
| InChIKey | MNEIVXPJHQVHOY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|