About 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate
3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate (PubChem CID 71987892) has the molecular formula C9H11ClN2O4
and a molecular weight of 246.65 g/mol. Its IUPAC name is 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate.
Molecular Properties
| Compound Name | 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate |
| PubChem CID | 71987892 |
| Molecular Formula | C9H11ClN2O4 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate |
| SMILES | NC(=O)NCCCOC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H11ClN2O4/c10-7-3-2-6(16-7)8(13)15-5-1-4-12-9(11)14/h2-3H,1,4-5H2,(H3,11,12,14) |
| InChIKey | IFSCEHFPYBAPMX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate?
The IUPAC name of 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate (CID 71987892) is 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate.
What is the SMILES notation for 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate?
The canonical SMILES for 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate is NC(=O)NCCCOC(=O)c1ccc(Cl)o1.
What is the InChIKey of 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate?
The InChIKey is IFSCEHFPYBAPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O4/c10-7-3-2-6(16-7)8(13)15-5-1-4-12-9(11)14/h2-3H,1,4-5H2,(H3,11,12,14).
What are the key properties of 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate?
3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate has a molecular weight of 246.65 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(carbamoylamino)propyl 5-chlorofuran-2-carboxylate is sourced from PubChem (CID 71987892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).