C11H15F3O2 — CID 101247938
2,2,2-trifluoroethyl (1R)-3,4-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 101247938) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1R)-3,4-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1R)-3,4-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 101247938 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2,2,2-trifluoroethyl (1R)-3,4-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C(C)C[C@H](C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O2/c1-7-3-4-9(5-8(7)2)10(15)16-6-11(12,13)14/h9H,3-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | DMNKTLNJZXUXJP-SECBINFHSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|