C13H20F3NO3 — CID 101248301
tert-butyl (2S)-3-methyl-2-[2-(trifluoromethyl)prop-2-enoylamino]butanoate (PubChem CID 101248301) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[2-(trifluoromethyl)prop-2-enoylamino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[2-(trifluoromethyl)prop-2-enoylamino]butanoate |
|---|---|
| PubChem CID | 101248301 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[2-(trifluoromethyl)prop-2-enoylamino]butanoate |
| SMILES | C=C(C(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-7(2)9(11(19)20-12(4,5)6)17-10(18)8(3)13(14,15)16/h7,9H,3H2,1-2,4-6H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | OQIPTOQCBWGODO-VIFPVBQESA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|