C28H44O — CID 101251715
(3aR,5bR,7aR,11aR,11bR,13aS,13bS)-5b,8,8,11a-tetramethyl-3a-propan-2-yl-1,2,3,4,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one (PubChem CID 101251715) has the molecular formula C28H44O and a molecular weight of 396.66 g/mol. Its IUPAC name is (3aR,5bR,7aR,11aR,11bR,13aS,13bS)-5b,8,8,11a-tetramethyl-3a-propan-2-yl-1,2,3,4,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one.
| Compound Name | (3aR,5bR,7aR,11aR,11bR,13aS,13bS)-5b,8,8,11a-tetramethyl-3a-propan-2-yl-1,2,3,4,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one |
|---|---|
| PubChem CID | 101251715 |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (3aR,5bR,7aR,11aR,11bR,13aS,13bS)-5b,8,8,11a-tetramethyl-3a-propan-2-yl-1,2,3,4,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one |
| SMILES | CC(C)[C@@]12CC=C3[C@@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]1CCC2 |
| InChI | InChI=1S/C28H44O/c1-18(2)28-14-7-8-21(28)19-9-10-23-26(5,20(19)11-17-28)15-12-22-25(3,4)24(29)13-16-27(22,23)6/h11,18-19,21-23H,7-10,12-17H2,1-6H3/t19-,21+,22+,23+,26+,27+,28-/m1/s1 |
| InChIKey | PAKMGJNJPGKUMB-RPBVTGBZSA-N |
| XLogP | 7.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|