C19H25NO6 — CID 101254753
methyl 4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-oxo-5-propan-2-ylpyrrole-3-carboxylate (PubChem CID 101254753) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-oxo-5-propan-2-ylpyrrole-3-carboxylate.
| Compound Name | methyl 4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-oxo-5-propan-2-ylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 101254753 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl 4,5-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-oxo-5-propan-2-ylpyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(OC)C(OC)(C(C)C)N(Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C19H25NO6/c1-12(2)19(26-6)16(24-4)15(18(22)25-5)17(21)20(19)11-13-7-9-14(23-3)10-8-13/h7-10,12H,11H2,1-6H3 |
| InChIKey | JJRDKVNPNJPWPF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|