C20H32N4O4 — CID 40517892
1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-propan-2-ylimidazolidin-4-yl]-3-propan-2-ylurea (PubChem CID 40517892) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-propan-2-ylimidazolidin-4-yl]-3-propan-2-ylurea.
| Compound Name | 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-propan-2-ylimidazolidin-4-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 40517892 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-propan-2-ylimidazolidin-4-yl]-3-propan-2-ylurea |
| SMILES | COc1ccc(CN2C(=O)N(C(C)C)[C@@H](N(O)C(=O)NC(C)C)C2(C)C)cc1 |
| InChI | InChI=1S/C20H32N4O4/c1-13(2)21-18(25)24(27)17-20(5,6)22(19(26)23(17)14(3)4)12-15-8-10-16(28-7)11-9-15/h8-11,13-14,17,27H,12H2,1-7H3,(H,21,25)/t17-/m0/s1 |
| InChIKey | URCZJBJDZHNWDN-KRWDZBQOSA-N |
| XLogP | 3.26 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|