C18H21NO5S — CID 101257427
tert-butyl (1R,4S,5R)-5-(4-methylphenyl)sulfonyl-6-oxo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 101257427) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is tert-butyl (1R,4S,5R)-5-(4-methylphenyl)sulfonyl-6-oxo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl (1R,4S,5R)-5-(4-methylphenyl)sulfonyl-6-oxo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 101257427 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | tert-butyl (1R,4S,5R)-5-(4-methylphenyl)sulfonyl-6-oxo-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2C(=O)[C@H]3C=C[C@@H]2N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-11-5-7-12(8-6-11)25(22,23)16-14-10-9-13(15(16)20)19(14)17(21)24-18(2,3)4/h5-10,13-14,16H,1-4H3/t13-,14+,16-/m1/s1 |
| InChIKey | HSHUICMDSLHIBV-IJEWVQPXSA-N |
| XLogP | 2.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|