C18H33N3O7 — CID 101260151
ditert-butyl (3S)-2-(hydrazinecarbonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 101260151) has the molecular formula C18H33N3O7 and a molecular weight of 403.48 g/mol. Its IUPAC name is ditert-butyl (3S)-2-(hydrazinecarbonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | ditert-butyl (3S)-2-(hydrazinecarbonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 101260151 |
| Molecular Formula | C18H33N3O7 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | ditert-butyl (3S)-2-(hydrazinecarbonyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)OC(C)(C)C)C(C(=O)NN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33N3O7/c1-16(2,3)26-13(23)10(12(22)21-19)11(14(24)27-17(4,5)6)20-15(25)28-18(7,8)9/h10-11H,19H2,1-9H3,(H,20,25)(H,21,22)/t10?,11-/m0/s1 |
| InChIKey | AAVQGXKIOLJZPB-DTIOYNMSSA-N |
| XLogP | 1.17 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|