C11H13N5S — CID 10126159
N'-(12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine (PubChem CID 10126159) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is N'-(12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine.
| Compound Name | N'-(12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 10126159 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N'-(12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
| SMILES | Cc1cnc2c(NCCN)nc3ccsc3n12 |
| InChI | InChI=1S/C11H13N5S/c1-7-6-14-10-9(13-4-3-12)15-8-2-5-17-11(8)16(7)10/h2,5-6H,3-4,12H2,1H3,(H,13,15) |
| InChIKey | NSSAAAYFAVFGIU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |