C14H15N7S — CID 73348798
N'-[4-(1H-imidazol-2-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine (PubChem CID 73348798) has the molecular formula C14H15N7S and a molecular weight of 313.39 g/mol. Its IUPAC name is N'-[4-(1H-imidazol-2-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine.
| Compound Name | N'-[4-(1H-imidazol-2-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 73348798 |
| Molecular Formula | C14H15N7S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N'-[4-(1H-imidazol-2-yl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]ethane-1,2-diamine |
| SMILES | Cc1cnc2c(NCCN)nc3cc(-c4ncc[nH]4)sc3n12 |
| InChI | InChI=1S/C14H15N7S/c1-8-7-19-13-12(16-3-2-15)20-9-6-10(11-17-4-5-18-11)22-14(9)21(8)13/h4-7H,2-3,15H2,1H3,(H,16,20)(H,17,18) |
| InChIKey | OECHNWOIJYZJLZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |