C25H20N2O5S — CID 101262226
(1S,3R,7R,8R,11R)-8-(3-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 101262226) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is (1S,3R,7R,8R,11R)-8-(3-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1S,3R,7R,8R,11R)-8-(3-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 101262226 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (1S,3R,7R,8R,11R)-8-(3-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | O=C1[C@H]2[C@H](c3cccc([N+](=O)[O-])c3)O[C@@]3(O[C@H](c4ccccc4)CN13)S[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H20N2O5S/c28-24-21-22(18-12-7-13-19(14-18)27(29)30)32-25(33-23(21)17-10-5-2-6-11-17)26(24)15-20(31-25)16-8-3-1-4-9-16/h1-14,20-23H,15H2/t20-,21-,22-,23-,25+/m0/s1 |
| InChIKey | OIVRQANDJSFIFB-IJELJUKBSA-N |
| XLogP | 4.98 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|