C24H26N2O5S — CID 24759408
(1R,4R,7S,8R,11R)-3,3-dimethyl-8-(3-nitrophenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 24759408) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is (1R,4R,7S,8R,11R)-3,3-dimethyl-8-(3-nitrophenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1R,4R,7S,8R,11R)-3,3-dimethyl-8-(3-nitrophenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 24759408 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (1R,4R,7S,8R,11R)-3,3-dimethyl-8-(3-nitrophenyl)-11-phenyl-4-propan-2-yl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | CC(C)[C@H]1N2C(=O)[C@@H]3[C@H](c4cccc([N+](=O)[O-])c4)O[C@]2(OC1(C)C)S[C@H]3c1ccccc1 |
| InChI | InChI=1S/C24H26N2O5S/c1-14(2)21-23(3,4)31-24-25(21)22(27)18(20(32-24)15-9-6-5-7-10-15)19(30-24)16-11-8-12-17(13-16)26(28)29/h5-14,18-21H,1-4H3/t18-,19+,20+,21-,24-/m1/s1 |
| InChIKey | ZFPQDFOONFNYLU-IZBDVAQHSA-N |
| XLogP | 5.04 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|