C31H24N2O5S — CID 177456862
(1S,3R,7R,8R,11R)-8-(4-nitrophenyl)-3,8,11-triphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 177456862) has the molecular formula C31H24N2O5S and a molecular weight of 536.61 g/mol. Its IUPAC name is (1S,3R,7R,8R,11R)-8-(4-nitrophenyl)-3,8,11-triphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | (1S,3R,7R,8R,11R)-8-(4-nitrophenyl)-3,8,11-triphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 177456862 |
| Molecular Formula | C31H24N2O5S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (1S,3R,7R,8R,11R)-8-(4-nitrophenyl)-3,8,11-triphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | O=C1[C@@H]2[C@H](c3ccccc3)S[C@@]3(O[C@H](c4ccccc4)CN13)O[C@]2(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H24N2O5S/c34-29-27-28(22-12-6-2-7-13-22)39-31(32(29)20-26(37-31)21-10-4-1-5-11-21)38-30(27,23-14-8-3-9-15-23)24-16-18-25(19-17-24)33(35)36/h1-19,26-28H,20H2/t26-,27-,28-,30+,31-/m0/s1 |
| InChIKey | RWBMLFAILXILGI-RJMJGXNGSA-N |
| XLogP | 6.18 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|