C27H26N2O6S — CID 24992632
(4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-methylsulfanyl-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 24992632) has the molecular formula C27H26N2O6S and a molecular weight of 506.58 g/mol. Its IUPAC name is (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-methylsulfanyl-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-methylsulfanyl-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24992632 |
| Molecular Formula | C27H26N2O6S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-methylsulfanyl-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CS[C@@H](c1ccccc1)[C@@H](C(=O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1C)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26N2O6S/c1-17-24(19-9-5-3-6-10-19)35-27(32)28(17)26(31)22(25(36-2)20-11-7-4-8-12-20)23(30)18-13-15-21(16-14-18)29(33)34/h3-17,22-25,30H,1-2H3/t17-,22-,23-,24-,25-/m0/s1 |
| InChIKey | KDQOSXWSOKVZTB-QAMDWANKSA-N |
| XLogP | 5.46 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|