C26H22N2O5S — CID 72778021
4-methyl-8-(4-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one (PubChem CID 72778021) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-methyl-8-(4-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one.
| Compound Name | 4-methyl-8-(4-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
|---|---|
| PubChem CID | 72778021 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 4-methyl-8-(4-nitrophenyl)-3,11-diphenyl-2,9-dioxa-10-thia-5-azatricyclo[5.2.2.01,5]undecan-6-one |
| SMILES | CC1C(c2ccccc2)OC23OC(c4ccc([N+](=O)[O-])cc4)C(C(=O)N12)C(c1ccccc1)S3 |
| InChI | InChI=1S/C26H22N2O5S/c1-16-22(17-8-4-2-5-9-17)32-26-27(16)25(29)21(24(34-26)19-10-6-3-7-11-19)23(33-26)18-12-14-20(15-13-18)28(30)31/h2-16,21-24H,1H3 |
| InChIKey | QOJFEWXFXLNDJR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|