C26H24N2O6S — CID 24992631
(4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-phenyl-3-sulfanylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 24992631) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-phenyl-3-sulfanylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-phenyl-3-sulfanylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24992631 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (4S,5R)-3-[(2R,3R)-2-[(R)-hydroxy-(4-nitrophenyl)methyl]-3-phenyl-3-sulfanylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)N1C(=O)[C@@H]([C@@H](O)c1ccc([N+](=O)[O-])cc1)[C@@H](S)c1ccccc1 |
| InChI | InChI=1S/C26H24N2O6S/c1-16-23(18-8-4-2-5-9-18)34-26(31)27(16)25(30)21(24(35)19-10-6-3-7-11-19)22(29)17-12-14-20(15-13-17)28(32)33/h2-16,21-24,29,35H,1H3/t16-,21-,22-,23-,24-/m0/s1 |
| InChIKey | FGLPJISGBCOAQF-AGIBEUSCSA-N |
| XLogP | 5.02 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|