C21H28O5 — CID 101262792
[(3bR,4R,9bR,10R)-10-hydroxy-3b,6,6-trimethyl-1-oxo-4,5,7,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate (PubChem CID 101262792) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(3bR,4R,9bR,10R)-10-hydroxy-3b,6,6-trimethyl-1-oxo-4,5,7,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate.
| Compound Name | [(3bR,4R,9bR,10R)-10-hydroxy-3b,6,6-trimethyl-1-oxo-4,5,7,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 101262792 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(3bR,4R,9bR,10R)-10-hydroxy-3b,6,6-trimethyl-1-oxo-4,5,7,8,9,9b,10,11-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2=C(CCCC2(C)C)[C@H]2[C@H](O)CC3=C(COC3=O)[C@]12C |
| InChI | InChI=1S/C21H28O5/c1-11(22)26-17-9-14-12(6-5-7-20(14,2)3)18-16(23)8-13-15(21(17,18)4)10-25-19(13)24/h16-18,23H,5-10H2,1-4H3/t16-,17-,18+,21-/m1/s1 |
| InChIKey | CPEFZMZILNBIMI-DCXXXQMHSA-N |
| XLogP | 3.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|