C18H26O7 — CID 156582276
[(3R,3'S,4S,6S,6'S,7R)-6,7-dihydroxy-4,6',7-trimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate (PubChem CID 156582276) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(3R,3'S,4S,6S,6'S,7R)-6,7-dihydroxy-4,6',7-trimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate.
| Compound Name | [(3R,3'S,4S,6S,6'S,7R)-6,7-dihydroxy-4,6',7-trimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate |
|---|---|
| PubChem CID | 156582276 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3R,3'S,4S,6S,6'S,7R)-6,7-dihydroxy-4,6',7-trimethyl-8-oxospiro[1,4,5,6-tetrahydroisochromene-3,2'-oxane]-3'-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H](C)O[C@@]12OCC1=C(C[C@H](O)[C@@](C)(O)C1=O)[C@@H]2C |
| InChI | InChI=1S/C18H26O7/c1-9-5-6-15(24-11(3)19)18(25-9)10(2)12-7-14(20)17(4,22)16(21)13(12)8-23-18/h9-10,14-15,20,22H,5-8H2,1-4H3/t9-,10-,14-,15-,17+,18+/m0/s1 |
| InChIKey | MQRSLEFTXDRECM-LBEPYRKWSA-N |
| XLogP | 0.86 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |