C16H22O7 — CID 162817327
[6,9-dihydroxy-3-(hydroxymethyl)-9-methyl-2-oxo-4,5,5a,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl] acetate (PubChem CID 162817327) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is [6,9-dihydroxy-3-(hydroxymethyl)-9-methyl-2-oxo-4,5,5a,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl] acetate.
| Compound Name | [6,9-dihydroxy-3-(hydroxymethyl)-9-methyl-2-oxo-4,5,5a,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl] acetate |
|---|---|
| PubChem CID | 162817327 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [6,9-dihydroxy-3-(hydroxymethyl)-9-methyl-2-oxo-4,5,5a,6,7,8,9a,9b-octahydrobenzo[g][1]benzofuran-8-yl] acetate |
| SMILES | CC(=O)OC1CC(O)C2CCC3=C(CO)C(=O)OC3C2C1(C)O |
| InChI | InChI=1S/C16H22O7/c1-7(18)22-12-5-11(19)9-4-3-8-10(6-17)15(20)23-14(8)13(9)16(12,2)21/h9,11-14,17,19,21H,3-6H2,1-2H3 |
| InChIKey | XLZCIXWVVZTPFO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |