C19H24O8 — CID 163063492
[(3S,3'S,4S,6'S)-4-acetyloxy-6,8-dihydroxy-6',7-dimethylspiro[1,4-dihydroisochromene-3,2'-oxane]-3'-yl] acetate (PubChem CID 163063492) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is [(3S,3'S,4S,6'S)-4-acetyloxy-6,8-dihydroxy-6',7-dimethylspiro[1,4-dihydroisochromene-3,2'-oxane]-3'-yl] acetate.
| Compound Name | [(3S,3'S,4S,6'S)-4-acetyloxy-6,8-dihydroxy-6',7-dimethylspiro[1,4-dihydroisochromene-3,2'-oxane]-3'-yl] acetate |
|---|---|
| PubChem CID | 163063492 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [(3S,3'S,4S,6'S)-4-acetyloxy-6,8-dihydroxy-6',7-dimethylspiro[1,4-dihydroisochromene-3,2'-oxane]-3'-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H](C)O[C@@]12OCc1c(cc(O)c(C)c1O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C19H24O8/c1-9-5-6-16(25-11(3)20)19(27-9)18(26-12(4)21)13-7-15(22)10(2)17(23)14(13)8-24-19/h7,9,16,18,22-23H,5-6,8H2,1-4H3/t9-,16-,18-,19-/m0/s1 |
| InChIKey | PLVLDRIHJAEAJS-OSXYSESHSA-N |
| XLogP | 2.37 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |