C30H36O8 — CID 163063462
2,4-dihydroxy-6-[(9-hydroxy-6',10,15-trimethylspiro[6,12,14-trioxatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),9-triene-5,2'-oxane]-13-yl)methyl]-3-methylbenzaldehyde (PubChem CID 163063462) has the molecular formula C30H36O8 and a molecular weight of 524.61 g/mol. Its IUPAC name is 2,4-dihydroxy-6-[(9-hydroxy-6',10,15-trimethylspiro[6,12,14-trioxatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),9-triene-5,2'-oxane]-13-yl)methyl]-3-methylbenzaldehyde.
| Compound Name | 2,4-dihydroxy-6-[(9-hydroxy-6',10,15-trimethylspiro[6,12,14-trioxatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),9-triene-5,2'-oxane]-13-yl)methyl]-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 163063462 |
| Molecular Formula | C30H36O8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2,4-dihydroxy-6-[(9-hydroxy-6',10,15-trimethylspiro[6,12,14-trioxatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3(8),9-triene-5,2'-oxane]-13-yl)methyl]-3-methylbenzaldehyde |
| SMILES | Cc1c(O)cc(CC23CC(CC(C)O2)c2c4c(c(O)c(C)c2O3)COC2(CCCC(C)O2)C4)c(C=O)c1O |
| InChI | InChI=1S/C30H36O8/c1-15-6-5-7-29(36-15)12-21-23(14-35-29)27(34)18(4)28-25(21)20-8-16(2)37-30(11-20,38-28)10-19-9-24(32)17(3)26(33)22(19)13-31/h9,13,15-16,20,32-34H,5-8,10-12,14H2,1-4H3 |
| InChIKey | YVSJLSKPUTUIRQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|