C15H18O6 — CID 170988369
(3S,4'R,6'S)-4',6,8-trihydroxy-6',7-dimethylspiro[4H-isochromene-3,2'-oxane]-1-one (PubChem CID 170988369) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (3S,4'R,6'S)-4',6,8-trihydroxy-6',7-dimethylspiro[4H-isochromene-3,2'-oxane]-1-one.
| Compound Name | (3S,4'R,6'S)-4',6,8-trihydroxy-6',7-dimethylspiro[4H-isochromene-3,2'-oxane]-1-one |
|---|---|
| PubChem CID | 170988369 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (3S,4'R,6'S)-4',6,8-trihydroxy-6',7-dimethylspiro[4H-isochromene-3,2'-oxane]-1-one |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)O[C@@]1(C2)C[C@H](O)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18O6/c1-7-3-10(16)6-15(20-7)5-9-4-11(17)8(2)13(18)12(9)14(19)21-15/h4,7,10,16-18H,3,5-6H2,1-2H3/t7-,10+,15-/m0/s1 |
| InChIKey | SLLUSFPFIBOWKE-UIJZGXCWSA-N |
| XLogP | 1.38 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |